ChemNet > CAS > 57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
termék neve |
methyl 2-[(cyanomethyl)thio]benzoate |
Angol név |
methyl 2-[(cyanomethyl)thio]benzoate;methyl 2-[(cyanomethyl)sulfanyl]benzoate |
MF |
C10H9NO2S |
Molekulatömeg |
207.249 |
InChI |
InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
CAS-szám |
57601-89-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.24g/cm3 |
Olvadáspont |
121℃ |
Forráspont |
338.6°C at 760 mmHg |
Törésmutató |
1.574 |
Gyulladáspont |
158.6°C |
Gőznyomás |
9.69E-05mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|